C27H48N+ — CID 57077910
1-(3,3-dipentylcyclohexyl)-1-azoniacyclododeca-4,8,12-triene (PubChem CID 57077910) has the molecular formula C27H48N+ and a molecular weight of 386.69 g/mol. Its IUPAC name is 1-(3,3-dipentylcyclohexyl)-1-azoniacyclododeca-4,8,12-triene.
| Compound Name | 1-(3,3-dipentylcyclohexyl)-1-azoniacyclododeca-4,8,12-triene |
|---|---|
| PubChem CID | 57077910 |
| Molecular Formula | C27H48N+ |
| Molecular Weight | 386.69 g/mol |
| Exact Mass | 386.38 |
| IUPAC Name | 1-(3,3-dipentylcyclohexyl)-1-azoniacyclododeca-4,8,12-triene |
| SMILES | CCCCCC1(CCCCC)CCCC(/[N+]2=C/CCC=CCCC=CCC2)C1 |
| InChI | InChI=1S/C27H48N/c1-3-5-14-20-27(21-15-6-4-2)22-18-19-26(25-27)28-23-16-12-10-8-7-9-11-13-17-24-28/h8,10-11,13,23,26H,3-7,9,12,14-22,24-25H2,1-2H3/q+1/b10-8?,13-11?,28-23+ |
| InChIKey | NZLSMEADPSJOTP-KUKXUYFESA-N |
| XLogP | 8.24 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.69 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|