C21H40N+ — CID 10736035
(2R,3S)-3,5-dibutyl-2-pentyl-1-propyl-2,3-dihydropyridin-1-ium (PubChem CID 10736035) has the molecular formula C21H40N+ and a molecular weight of 306.56 g/mol. Its IUPAC name is (2R,3S)-3,5-dibutyl-2-pentyl-1-propyl-2,3-dihydropyridin-1-ium.
| Compound Name | (2R,3S)-3,5-dibutyl-2-pentyl-1-propyl-2,3-dihydropyridin-1-ium |
|---|---|
| PubChem CID | 10736035 |
| Molecular Formula | C21H40N+ |
| Molecular Weight | 306.56 g/mol |
| Exact Mass | 306.32 |
| IUPAC Name | (2R,3S)-3,5-dibutyl-2-pentyl-1-propyl-2,3-dihydropyridin-1-ium |
| SMILES | CCCCC[C@@H]1[C@@H](CCCC)C=C(CCCC)C=[N+]1CCC |
| InChI | InChI=1S/C21H40N/c1-5-9-12-15-21-20(14-11-7-3)17-19(13-10-6-2)18-22(21)16-8-4/h17-18,20-21H,5-16H2,1-4H3/q+1/t20-,21+/m0/s1 |
| InChIKey | PFGWXPMLCMYWRH-LEWJYISDSA-N |
| XLogP | 6.37 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.56 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|