C20H34N2 — CID 177219612
N,4-dimethyl-4-[(1E,3Z)-5-methyliminopenta-1,3-dienyl]-N-(4-methylpent-1-en-3-yl)cyclohexan-1-amine (PubChem CID 177219612) has the molecular formula C20H34N2 and a molecular weight of 302.51 g/mol. Its IUPAC name is N,4-dimethyl-4-[(1E,3Z)-5-methyliminopenta-1,3-dienyl]-N-(4-methylpent-1-en-3-yl)cyclohexan-1-amine.
| Compound Name | N,4-dimethyl-4-[(1E,3Z)-5-methyliminopenta-1,3-dienyl]-N-(4-methylpent-1-en-3-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 177219612 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | N,4-dimethyl-4-[(1E,3Z)-5-methyliminopenta-1,3-dienyl]-N-(4-methylpent-1-en-3-yl)cyclohexan-1-amine |
| SMILES | C=CC(C(C)C)N(C)C1CCC(C)(/C=C/C=C\C=N\C)CC1 |
| InChI | InChI=1S/C20H34N2/c1-7-19(17(2)3)22(6)18-11-14-20(4,15-12-18)13-9-8-10-16-21-5/h7-10,13,16-19H,1,11-12,14-15H2,2-6H3/b10-8-,13-9+,21-16+ |
| InChIKey | CREHCESSZIJSFK-UEVWMIKCSA-N |
| XLogP | 4.89 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|