C27H50N+ — CID 57133339
1-(3-pentyl-3-propyloctyl)-1-azoniacyclododeca-4,8,12-triene (PubChem CID 57133339) has the molecular formula C27H50N+ and a molecular weight of 388.70 g/mol. Its IUPAC name is 1-(3-pentyl-3-propyloctyl)-1-azoniacyclododeca-4,8,12-triene.
| Compound Name | 1-(3-pentyl-3-propyloctyl)-1-azoniacyclododeca-4,8,12-triene |
|---|---|
| PubChem CID | 57133339 |
| Molecular Formula | C27H50N+ |
| Molecular Weight | 388.70 g/mol |
| Exact Mass | 388.39 |
| IUPAC Name | 1-(3-pentyl-3-propyloctyl)-1-azoniacyclododeca-4,8,12-triene |
| SMILES | CCCCCC(CCC)(CCCCC)CC/[N+]1=C/CCC=CCCC=CCC1 |
| InChI | InChI=1S/C27H50N/c1-4-7-16-21-27(20-6-3,22-17-8-5-2)23-26-28-24-18-14-12-10-9-11-13-15-19-25-28/h10,12-13,15,24H,4-9,11,14,16-23,25-26H2,1-3H3/q+1/b12-10?,15-13?,28-24+ |
| InChIKey | ZYQGMZAXIWXHDV-PJRIHQOXSA-N |
| XLogP | 8.48 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.70 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|