C25H51N — CID 150539852
(Z)-N,N,3,3-tetramethylhenicos-12-en-1-amine (PubChem CID 150539852) has the molecular formula C25H51N and a molecular weight of 365.69 g/mol. Its IUPAC name is (Z)-N,N,3,3-tetramethylhenicos-12-en-1-amine.
| Compound Name | (Z)-N,N,3,3-tetramethylhenicos-12-en-1-amine |
|---|---|
| PubChem CID | 150539852 |
| Molecular Formula | C25H51N |
| Molecular Weight | 365.69 g/mol |
| Exact Mass | 365.40 |
| IUPAC Name | (Z)-N,N,3,3-tetramethylhenicos-12-en-1-amine |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC(C)(C)CCN(C)C |
| InChI | InChI=1S/C25H51N/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-25(2,3)23-24-26(4)5/h13-14H,6-12,15-24H2,1-5H3/b14-13- |
| InChIKey | IFQIAJQTAWSCGF-YPKPFQOOSA-N |
| XLogP | 8.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.69 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|