C15H27N — CID 123154718
7-ethyl-7-hex-2-enyl-3,4,5,6-tetrahydro-2H-azocine (PubChem CID 123154718) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is 7-ethyl-7-hex-2-enyl-3,4,5,6-tetrahydro-2H-azocine.
| Compound Name | 7-ethyl-7-hex-2-enyl-3,4,5,6-tetrahydro-2H-azocine |
|---|---|
| PubChem CID | 123154718 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 7-ethyl-7-hex-2-enyl-3,4,5,6-tetrahydro-2H-azocine |
| SMILES | CCCC=CCC1(CC)/C=N\CCCCC1 |
| InChI | InChI=1S/C15H27N/c1-3-5-6-8-11-15(4-2)12-9-7-10-13-16-14-15/h6,8,14H,3-5,7,9-13H2,1-2H3/b8-6?,16-14- |
| InChIKey | VBIBBNTXYCVSAF-LXMSGDBZSA-N |
| XLogP | 4.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|