C22H40N+ — CID 123551976
(3,5-diethyl-7,10-dimethyl-7-prop-1-enylundeca-2,8-dienylidene)-dimethylazanium (PubChem CID 123551976) has the molecular formula C22H40N+ and a molecular weight of 318.57 g/mol. Its IUPAC name is (3,5-diethyl-7,10-dimethyl-7-prop-1-enylundeca-2,8-dienylidene)-dimethylazanium.
| Compound Name | (3,5-diethyl-7,10-dimethyl-7-prop-1-enylundeca-2,8-dienylidene)-dimethylazanium |
|---|---|
| PubChem CID | 123551976 |
| Molecular Formula | C22H40N+ |
| Molecular Weight | 318.57 g/mol |
| Exact Mass | 318.32 |
| IUPAC Name | (3,5-diethyl-7,10-dimethyl-7-prop-1-enylundeca-2,8-dienylidene)-dimethylazanium |
| SMILES | CC=CC(C)(C=CC(C)C)CC(CC)CC(=CC=[N+](C)C)CC |
| InChI | InChI=1S/C22H40N/c1-9-14-22(6,15-12-19(4)5)18-21(11-3)17-20(10-2)13-16-23(7)8/h9,12-16,19,21H,10-11,17-18H2,1-8H3/q+1 |
| InChIKey | MIQZFILSXCULDW-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.57 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|