C36H58N2 — CID 163501269
4-butyl-3-(cyclopropylidenemethyl)-N-methyl-N-[5-methyl-6-(2-methylbutylimino)-2-propylhexyl]dodeca-4,5,6,7,8,9-hexaen-1-amine (PubChem CID 163501269) has the molecular formula C36H58N2 and a molecular weight of 518.87 g/mol. Its IUPAC name is 4-butyl-3-(cyclopropylidenemethyl)-N-methyl-N-[5-methyl-6-(2-methylbutylimino)-2-propylhexyl]dodeca-4,5,6,7,8,9-hexaen-1-amine.
| Compound Name | 4-butyl-3-(cyclopropylidenemethyl)-N-methyl-N-[5-methyl-6-(2-methylbutylimino)-2-propylhexyl]dodeca-4,5,6,7,8,9-hexaen-1-amine |
|---|---|
| PubChem CID | 163501269 |
| Molecular Formula | C36H58N2 |
| Molecular Weight | 518.87 g/mol |
| Exact Mass | 518.46 |
| IUPAC Name | 4-butyl-3-(cyclopropylidenemethyl)-N-methyl-N-[5-methyl-6-(2-methylbutylimino)-2-propylhexyl]dodeca-4,5,6,7,8,9-hexaen-1-amine |
| SMILES | CCC=C=C=C=C=C=C(CCCC)C(C=C1CC1)CCN(C)CC(CCC)CCC(C)/C=N/CC(C)CC |
| InChI | InChI=1S/C36H58N2/c1-8-12-14-15-16-17-20-35(19-13-9-2)36(27-33-23-24-33)25-26-38(7)30-34(18-10-3)22-21-32(6)29-37-28-31(5)11-4/h12,27,29,31-32,34,36H,8-11,13,18-19,21-26,28,30H2,1-7H3/b37-29+ |
| InChIKey | CUYNFBYGXGWXNI-SMTCOIIISA-N |
| XLogP | 9.90 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.87 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|