C11H16N2 — CID 123653923
(4aZ)-10-methyl-2,3,4,8,9,10-hexahydropyrido[3,2-d]azocine (PubChem CID 123653923) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is (4aZ)-10-methyl-2,3,4,8,9,10-hexahydropyrido[3,2-d]azocine.
| Compound Name | (4aZ)-10-methyl-2,3,4,8,9,10-hexahydropyrido[3,2-d]azocine |
|---|---|
| PubChem CID | 123653923 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | (4aZ)-10-methyl-2,3,4,8,9,10-hexahydropyrido[3,2-d]azocine |
| SMILES | CC1CC/N=C\C=C2\CCCN=C21 |
| InChI | InChI=1S/C11H16N2/c1-9-4-7-12-8-5-10-3-2-6-13-11(9)10/h5,8-9H,2-4,6-7H2,1H3/b10-5-,12-8- |
| InChIKey | STKJAIWVOFFYDP-HFHLANHYSA-N |
| XLogP | 2.26 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |