C14H16N2 — CID 57273726
8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-4(11),5,8,14-tetraene (PubChem CID 57273726) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-4(11),5,8,14-tetraene.
| Compound Name | 8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-4(11),5,8,14-tetraene |
|---|---|
| PubChem CID | 57273726 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-4(11),5,8,14-tetraene |
| SMILES | C1=CC2=C3CCC4=NC(CC3/C=N\C1)CC42 |
| InChI | InChI=1S/C14H16N2/c1-2-12-11-3-4-14-13(12)7-10(16-14)6-9(11)8-15-5-1/h1-2,8-10,13H,3-7H2/b2-1?,15-8- |
| InChIKey | KUENHWBXZMTSIN-FPLHAZIMSA-N |
| XLogP | 2.57 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |