C19H35N — CID 123727677
10-ethyl-2,11-dimethyl-8-propyl-1-azacyclotrideca-6,13-diene (PubChem CID 123727677) has the molecular formula C19H35N and a molecular weight of 277.50 g/mol. Its IUPAC name is 10-ethyl-2,11-dimethyl-8-propyl-1-azacyclotrideca-6,13-diene.
| Compound Name | 10-ethyl-2,11-dimethyl-8-propyl-1-azacyclotrideca-6,13-diene |
|---|---|
| PubChem CID | 123727677 |
| Molecular Formula | C19H35N |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.28 |
| IUPAC Name | 10-ethyl-2,11-dimethyl-8-propyl-1-azacyclotrideca-6,13-diene |
| SMILES | CCCC1C=CCCCC(C)/N=C\CC(C)C(CC)C1 |
| InChI | InChI=1S/C19H35N/c1-5-10-18-12-9-7-8-11-17(4)20-14-13-16(3)19(6-2)15-18/h9,12,14,16-19H,5-8,10-11,13,15H2,1-4H3/b12-9?,20-14- |
| InChIKey | PLBUICWWQGPUSC-CSQXJJNYSA-N |
| XLogP | 6.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|