C23H40N3+ — CID 123849526
[1-(2,3,4,5,6,9-hexahydroazecin-4-yl)-5-methylhex-5-en-2-ylidene]-methyl-[3-methyl-4-(methylamino)but-2-enyl]azanium (PubChem CID 123849526) has the molecular formula C23H40N3+ and a molecular weight of 358.59 g/mol. Its IUPAC name is [1-(2,3,4,5,6,9-hexahydroazecin-4-yl)-5-methylhex-5-en-2-ylidene]-methyl-[3-methyl-4-(methylamino)but-2-enyl]azanium.
| Compound Name | [1-(2,3,4,5,6,9-hexahydroazecin-4-yl)-5-methylhex-5-en-2-ylidene]-methyl-[3-methyl-4-(methylamino)but-2-enyl]azanium |
|---|---|
| PubChem CID | 123849526 |
| Molecular Formula | C23H40N3+ |
| Molecular Weight | 358.59 g/mol |
| Exact Mass | 358.32 |
| IUPAC Name | [1-(2,3,4,5,6,9-hexahydroazecin-4-yl)-5-methylhex-5-en-2-ylidene]-methyl-[3-methyl-4-(methylamino)but-2-enyl]azanium |
| SMILES | C=C(C)CC/C(CC1CCC=CC/C=N\CC1)=[N+](/C)CC=C(C)CNC |
| InChI | InChI=1S/C23H40N3/c1-20(2)11-12-23(26(5)17-14-21(3)19-24-4)18-22-10-8-6-7-9-15-25-16-13-22/h6-7,14-15,22,24H,1,8-13,16-19H2,2-5H3/q+1/b7-6?,21-14?,25-15-,26-23+ |
| InChIKey | HFUNQJWTVUGSQE-XVKNQSCZSA-N |
| XLogP | 4.80 |
| TPSA | 27.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|