C24H42N2 — CID 142044106
(Z,7Z)-4-methylidene-1-methylimino-3-[(Z)-pent-3-enyl]-N-propyl-7-propylideneundec-8-en-2-amine (PubChem CID 142044106) has the molecular formula C24H42N2 and a molecular weight of 358.61 g/mol. Its IUPAC name is (Z,7Z)-4-methylidene-1-methylimino-3-[(Z)-pent-3-enyl]-N-propyl-7-propylideneundec-8-en-2-amine.
| Compound Name | (Z,7Z)-4-methylidene-1-methylimino-3-[(Z)-pent-3-enyl]-N-propyl-7-propylideneundec-8-en-2-amine |
|---|---|
| PubChem CID | 142044106 |
| Molecular Formula | C24H42N2 |
| Molecular Weight | 358.61 g/mol |
| Exact Mass | 358.33 |
| IUPAC Name | (Z,7Z)-4-methylidene-1-methylimino-3-[(Z)-pent-3-enyl]-N-propyl-7-propylideneundec-8-en-2-amine |
| SMILES | C=C(CCC(/C=C\CC)=C/CC)C(CC/C=C\C)C(/C=N/C)NCCC |
| InChI | InChI=1S/C24H42N2/c1-7-11-13-16-23(24(20-25-6)26-19-10-4)21(5)17-18-22(14-9-3)15-12-8-2/h7,11-12,14-15,20,23-24,26H,5,8-10,13,16-19H2,1-4,6H3/b11-7-,15-12-,22-14+,25-20+ |
| InChIKey | BAQNICUWGHDZDN-OPPYZCNMSA-N |
| XLogP | 6.67 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.61 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|