C31H61N3 — CID 146336881
N'-[(7E,11E)-6-methanimidoyl-8-methyl-14-propan-2-ylicosa-7,11-dienyl]hexane-1,6-diamine (PubChem CID 146336881) has the molecular formula C31H61N3 and a molecular weight of 475.85 g/mol. Its IUPAC name is N'-[(7E,11E)-6-methanimidoyl-8-methyl-14-propan-2-ylicosa-7,11-dienyl]hexane-1,6-diamine.
| Compound Name | N'-[(7E,11E)-6-methanimidoyl-8-methyl-14-propan-2-ylicosa-7,11-dienyl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 146336881 |
| Molecular Formula | C31H61N3 |
| Molecular Weight | 475.85 g/mol |
| Exact Mass | 475.49 |
| IUPAC Name | N'-[(7E,11E)-6-methanimidoyl-8-methyl-14-propan-2-ylicosa-7,11-dienyl]hexane-1,6-diamine |
| SMILES | [H]/N=C/C(/C=C(\C)CC/C=C/CC(CCCCCC)C(C)C)CCCCCNCCCCCCN |
| InChI | InChI=1S/C31H61N3/c1-5-6-7-14-21-31(28(2)3)22-15-10-12-19-29(4)26-30(27-33)20-13-11-18-25-34-24-17-9-8-16-23-32/h10,15,26-28,30-31,33-34H,5-9,11-14,16-25,32H2,1-4H3/b15-10+,29-26+,33-27+ |
| InChIKey | SMNLQRRKNINKCG-ADMGGCOZSA-N |
| XLogP | 8.84 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.85 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|