C39H72N2 — CID 90806351
N-butyl-3-[3-[[(E)-4-(3-ethylcyclobutyl)-2-methylbut-2-enylidene]amino]butan-2-yl]-1-(6-ethyl-8-methylcyclooct-3-en-1-yl)-5-methyloctan-1-amine (PubChem CID 90806351) has the molecular formula C39H72N2 and a molecular weight of 569.02 g/mol. Its IUPAC name is N-butyl-3-[3-[[(E)-4-(3-ethylcyclobutyl)-2-methylbut-2-enylidene]amino]butan-2-yl]-1-(6-ethyl-8-methylcyclooct-3-en-1-yl)-5-methyloctan-1-amine.
| Compound Name | N-butyl-3-[3-[[(E)-4-(3-ethylcyclobutyl)-2-methylbut-2-enylidene]amino]butan-2-yl]-1-(6-ethyl-8-methylcyclooct-3-en-1-yl)-5-methyloctan-1-amine |
|---|---|
| PubChem CID | 90806351 |
| Molecular Formula | C39H72N2 |
| Molecular Weight | 569.02 g/mol |
| Exact Mass | 568.57 |
| IUPAC Name | N-butyl-3-[3-[[(E)-4-(3-ethylcyclobutyl)-2-methylbut-2-enylidene]amino]butan-2-yl]-1-(6-ethyl-8-methylcyclooct-3-en-1-yl)-5-methyloctan-1-amine |
| SMILES | CCCCNC(CC(CC(C)CCC)C(C)C(C)/N=C/C(C)=C/CC1CC(CC)C1)C1CC=CCC(CC)CC1C |
| InChI | InChI=1S/C39H72N2/c1-10-14-22-40-39(38-19-16-15-18-34(12-3)24-31(38)7)27-37(23-29(5)17-11-2)32(8)33(9)41-28-30(6)20-21-36-25-35(13-4)26-36/h15-16,20,28-29,31-40H,10-14,17-19,21-27H2,1-9H3/b16-15?,30-20+,41-28+ |
| InChIKey | ZSYSGHYAPNYFIU-FTUAMPODSA-N |
| XLogP | 11.46 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.02 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|