C26H48N2 — CID 142044105
ethane;(Z,7Z)-4-methylidene-1-methylimino-3-[(Z)-pent-3-enyl]-N-propyl-7-propylideneundec-8-en-2-amine (PubChem CID 142044105) has the molecular formula C26H48N2 and a molecular weight of 388.68 g/mol. Its IUPAC name is ethane;(Z,7Z)-4-methylidene-1-methylimino-3-[(Z)-pent-3-enyl]-N-propyl-7-propylideneundec-8-en-2-amine.
| Compound Name | ethane;(Z,7Z)-4-methylidene-1-methylimino-3-[(Z)-pent-3-enyl]-N-propyl-7-propylideneundec-8-en-2-amine |
|---|---|
| PubChem CID | 142044105 |
| Molecular Formula | C26H48N2 |
| Molecular Weight | 388.68 g/mol |
| Exact Mass | 388.38 |
| IUPAC Name | ethane;(Z,7Z)-4-methylidene-1-methylimino-3-[(Z)-pent-3-enyl]-N-propyl-7-propylideneundec-8-en-2-amine |
| SMILES | C=C(CCC(/C=C\CC)=C/CC)C(CC/C=C\C)C(/C=N/C)NCCC.CC |
| InChI | InChI=1S/C24H42N2.C2H6/c1-7-11-13-16-23(24(20-25-6)26-19-10-4)21(5)17-18-22(14-9-3)15-12-8-2;1-2/h7,11-12,14-15,20,23-24,26H,5,8-10,13,16-19H2,1-4,6H3;1-2H3/b11-7-,15-12-,22-14+,25-20+; |
| InChIKey | UJAOVEPMNNQINO-YYOVOFFPSA-N |
| XLogP | 7.69 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.68 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|