C20H37N2+ — CID 178080485
[7-(4-ethylidenecyclohexyl)-5-(pentylideneamino)heptan-3-ylidene]azanium (PubChem CID 178080485) has the molecular formula C20H37N2+ and a molecular weight of 305.53 g/mol. Its IUPAC name is [7-(4-ethylidenecyclohexyl)-5-(pentylideneamino)heptan-3-ylidene]azanium.
| Compound Name | [7-(4-ethylidenecyclohexyl)-5-(pentylideneamino)heptan-3-ylidene]azanium |
|---|---|
| PubChem CID | 178080485 |
| Molecular Formula | C20H37N2+ |
| Molecular Weight | 305.53 g/mol |
| Exact Mass | 305.30 |
| IUPAC Name | [7-(4-ethylidenecyclohexyl)-5-(pentylideneamino)heptan-3-ylidene]azanium |
| SMILES | CC=C1CCC(CCC(CC(=[NH2+])CC)/N=C/CCCC)CC1 |
| InChI | InChI=1S/C20H36N2/c1-4-7-8-15-22-20(16-19(21)6-3)14-13-18-11-9-17(5-2)10-12-18/h5,15,18,20-21H,4,6-14,16H2,1-3H3/p+1/b17-5-,21-19?,22-15+ |
| InChIKey | GJKSAZXXWONFRD-LLUPVEIASA-O |
| XLogP | 4.53 |
| TPSA | 37.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|