C12H24N2 — CID 177026198
(Z)-N,2-diethyl-3-(methyliminomethyl)hex-3-en-1-amine (PubChem CID 177026198) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is (Z)-N,2-diethyl-3-(methyliminomethyl)hex-3-en-1-amine.
| Compound Name | (Z)-N,2-diethyl-3-(methyliminomethyl)hex-3-en-1-amine |
|---|---|
| PubChem CID | 177026198 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | (Z)-N,2-diethyl-3-(methyliminomethyl)hex-3-en-1-amine |
| SMILES | CC/C=C(\C=N\C)C(CC)CNCC |
| InChI | InChI=1S/C12H24N2/c1-5-8-12(9-13-4)11(6-2)10-14-7-3/h8-9,11,14H,5-7,10H2,1-4H3/b12-8+,13-9+ |
| InChIKey | KINPHIQNBHYPFO-QHKWOANTSA-N |
| XLogP | 2.66 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|