C10H18N2 — CID 123937374
5-(azetidin-3-yl)-N,2-dimethylpent-2-en-1-imine (PubChem CID 123937374) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 5-(azetidin-3-yl)-N,2-dimethylpent-2-en-1-imine.
| Compound Name | 5-(azetidin-3-yl)-N,2-dimethylpent-2-en-1-imine |
|---|---|
| PubChem CID | 123937374 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 5-(azetidin-3-yl)-N,2-dimethylpent-2-en-1-imine |
| SMILES | C/N=C/C(C)=CCCC1CNC1 |
| InChI | InChI=1S/C10H18N2/c1-9(6-11-2)4-3-5-10-7-12-8-10/h4,6,10,12H,3,5,7-8H2,1-2H3/b9-4?,11-6+ |
| InChIKey | OHHRNRLCNZSSAW-VEOHEGGASA-N |
| XLogP | 1.63 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|