C22H36N2 — CID 123728852
3-buta-1,3-dienyl-8-ethenyl-4-(2-iminoethyl)-N-methyltrideca-2,10-dien-1-amine (PubChem CID 123728852) has the molecular formula C22H36N2 and a molecular weight of 328.54 g/mol. Its IUPAC name is 3-buta-1,3-dienyl-8-ethenyl-4-(2-iminoethyl)-N-methyltrideca-2,10-dien-1-amine.
| Compound Name | 3-buta-1,3-dienyl-8-ethenyl-4-(2-iminoethyl)-N-methyltrideca-2,10-dien-1-amine |
|---|---|
| PubChem CID | 123728852 |
| Molecular Formula | C22H36N2 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.29 |
| IUPAC Name | 3-buta-1,3-dienyl-8-ethenyl-4-(2-iminoethyl)-N-methyltrideca-2,10-dien-1-amine |
| SMILES | [H]/N=C/CC(CCCC(C=C)CC=CCC)C(C=CC=C)=CCNC |
| InChI | InChI=1S/C22H36N2/c1-5-8-10-12-20(7-3)13-11-15-21(16-18-23)22(14-9-6-2)17-19-24-4/h6-10,14,17-18,20-21,23-24H,2-3,5,11-13,15-16,19H2,1,4H3/b10-8?,14-9?,22-17?,23-18+ |
| InChIKey | QGZFDJIPDYQMDC-XENAFZGNSA-N |
| XLogP | 5.86 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|