C17H32N2 — CID 166963206
N-butyl-2-[(5-ethylcyclohepten-1-yl)methyl]-3-iminopropan-1-amine (PubChem CID 166963206) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is N-butyl-2-[(5-ethylcyclohepten-1-yl)methyl]-3-iminopropan-1-amine.
| Compound Name | N-butyl-2-[(5-ethylcyclohepten-1-yl)methyl]-3-iminopropan-1-amine |
|---|---|
| PubChem CID | 166963206 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | N-butyl-2-[(5-ethylcyclohepten-1-yl)methyl]-3-iminopropan-1-amine |
| SMILES | [H]/N=C/C(CNCCCC)CC1=CCCC(CC)CC1 |
| InChI | InChI=1S/C17H32N2/c1-3-5-11-19-14-17(13-18)12-16-8-6-7-15(4-2)9-10-16/h8,13,15,17-19H,3-7,9-12,14H2,1-2H3/b18-13+ |
| InChIKey | UBRUPXDRTAWDQL-QGOAFFKASA-N |
| XLogP | 4.56 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|