C25H51N — CID 123594746
N-(3,5-diethyl-2-methylhept-3-enyl)-6-ethylundecan-1-amine (PubChem CID 123594746) has the molecular formula C25H51N and a molecular weight of 365.69 g/mol. Its IUPAC name is N-(3,5-diethyl-2-methylhept-3-enyl)-6-ethylundecan-1-amine.
| Compound Name | N-(3,5-diethyl-2-methylhept-3-enyl)-6-ethylundecan-1-amine |
|---|---|
| PubChem CID | 123594746 |
| Molecular Formula | C25H51N |
| Molecular Weight | 365.69 g/mol |
| Exact Mass | 365.40 |
| IUPAC Name | N-(3,5-diethyl-2-methylhept-3-enyl)-6-ethylundecan-1-amine |
| SMILES | CCCCCC(CC)CCCCCNCC(C)C(=CC(CC)CC)CC |
| InChI | InChI=1S/C25H51N/c1-7-12-14-17-24(10-4)18-15-13-16-19-26-21-22(6)25(11-5)20-23(8-2)9-3/h20,22-24,26H,7-19,21H2,1-6H3 |
| InChIKey | ADSFWOILWOLOMT-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.69 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|