C21H44N2 — CID 142284540
N-ethylethanamine;(E)-2,4,5,8,11-pentamethyldodec-3-en-1-imine (PubChem CID 142284540) has the molecular formula C21H44N2 and a molecular weight of 324.60 g/mol. Its IUPAC name is N-ethylethanamine;(E)-2,4,5,8,11-pentamethyldodec-3-en-1-imine.
| Compound Name | N-ethylethanamine;(E)-2,4,5,8,11-pentamethyldodec-3-en-1-imine |
|---|---|
| PubChem CID | 142284540 |
| Molecular Formula | C21H44N2 |
| Molecular Weight | 324.60 g/mol |
| Exact Mass | 324.35 |
| IUPAC Name | N-ethylethanamine;(E)-2,4,5,8,11-pentamethyldodec-3-en-1-imine |
| SMILES | CCNCC.[H]/N=C/C(C)/C=C(\C)C(C)CCC(C)CCC(C)C |
| InChI | InChI=1S/C17H33N.C4H11N/c1-13(2)7-8-14(3)9-10-16(5)17(6)11-15(4)12-18;1-3-5-4-2/h11-16,18H,7-10H2,1-6H3;5H,3-4H2,1-2H3/b17-11+,18-12+; |
| InChIKey | NHSSLDJHYLIJGY-OYJDLGDISA-N |
| XLogP | 6.32 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.60 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|