C22H34N2 — CID 142584339
(2E,4Z,6E,7Z)-6-ethylidene-4-[(3E)-hexa-1,3-dien-3-yl]-7-methanimidoyl-N,9-dimethylundeca-2,4,7-trien-2-amine (PubChem CID 142584339) has the molecular formula C22H34N2 and a molecular weight of 326.53 g/mol. Its IUPAC name is (2E,4Z,6E,7Z)-6-ethylidene-4-[(3E)-hexa-1,3-dien-3-yl]-7-methanimidoyl-N,9-dimethylundeca-2,4,7-trien-2-amine.
| Compound Name | (2E,4Z,6E,7Z)-6-ethylidene-4-[(3E)-hexa-1,3-dien-3-yl]-7-methanimidoyl-N,9-dimethylundeca-2,4,7-trien-2-amine |
|---|---|
| PubChem CID | 142584339 |
| Molecular Formula | C22H34N2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | (2E,4Z,6E,7Z)-6-ethylidene-4-[(3E)-hexa-1,3-dien-3-yl]-7-methanimidoyl-N,9-dimethylundeca-2,4,7-trien-2-amine |
| SMILES | [H]/N=C/C(=C\C(C)CC)C(=C/C)/C=C(\C=C(/C)NC)C(/C=C)=C/CC |
| InChI | InChI=1S/C22H34N2/c1-8-12-19(10-3)21(14-18(6)24-7)15-20(11-4)22(16-23)13-17(5)9-2/h10-17,23-24H,3,8-9H2,1-2,4-7H3/b18-14+,19-12+,20-11+,21-15-,22-13+,23-16+ |
| InChIKey | PCDPCRXLIVGDEO-XGISUNHISA-N |
| XLogP | 6.13 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|