C9H14N2 — CID 144950458
6-methanimidoyl-N,4-dimethylcyclohexa-1,5-dien-1-amine (PubChem CID 144950458) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 6-methanimidoyl-N,4-dimethylcyclohexa-1,5-dien-1-amine.
| Compound Name | 6-methanimidoyl-N,4-dimethylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 144950458 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 6-methanimidoyl-N,4-dimethylcyclohexa-1,5-dien-1-amine |
| SMILES | [H]/N=C/C1=CC(C)CC=C1NC |
| InChI | InChI=1S/C9H14N2/c1-7-3-4-9(11-2)8(5-7)6-10/h4-7,10-11H,3H2,1-2H3/b10-6+ |
| InChIKey | QWUCUMKECNGXSW-UXBLZVDNSA-N |
| XLogP | 1.71 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|