About (6Z)-5-methylidene-6-propylidene-1,2-dihydropyrimidine
(6Z)-5-methylidene-6-propylidene-1,2-dihydropyrimidine (PubChem CID 130389549) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is (6Z)-5-methylidene-6-propylidene-1,2-dihydropyrimidine.
Analyze (6Z)-5-methylidene-6-propylidene-1,2-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-5-methylidene-6-propylidene-1,2-dihydropyrimidine?
The IUPAC name of (6Z)-5-methylidene-6-propylidene-1,2-dihydropyrimidine (CID 130389549) is (6Z)-5-methylidene-6-propylidene-1,2-dihydropyrimidine.
What is the SMILES notation for (6Z)-5-methylidene-6-propylidene-1,2-dihydropyrimidine?
The canonical SMILES for (6Z)-5-methylidene-6-propylidene-1,2-dihydropyrimidine is C=C1C=NCN/C1=C\CC.
What is the InChIKey of (6Z)-5-methylidene-6-propylidene-1,2-dihydropyrimidine?
The InChIKey is CCADUYKSCKQFLN-YWEYNIOJSA-N. The full InChI is InChI=1S/C8H12N2/c1-3-4-8-7(2)5-9-6-10-8/h4-5,10H,2-3,6H2,1H3/b8-4-.
What are the key properties of (6Z)-5-methylidene-6-propylidene-1,2-dihydropyrimidine?
(6Z)-5-methylidene-6-propylidene-1,2-dihydropyrimidine has a molecular weight of 136.20 g/mol, XLogP of 1.47, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-5-methylidene-6-propylidene-1,2-dihydropyrimidine is sourced from PubChem (CID 130389549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).