C9H15N3 — CID 139358447
(Z)-4-imino-3-(1,2,3,6-tetrahydropyridin-5-yl)but-2-en-2-amine (PubChem CID 139358447) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is (Z)-4-imino-3-(1,2,3,6-tetrahydropyridin-5-yl)but-2-en-2-amine.
| Compound Name | (Z)-4-imino-3-(1,2,3,6-tetrahydropyridin-5-yl)but-2-en-2-amine |
|---|---|
| PubChem CID | 139358447 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | (Z)-4-imino-3-(1,2,3,6-tetrahydropyridin-5-yl)but-2-en-2-amine |
| SMILES | [H]/N=C/C(C1=CCCNC1)=C(/C)N |
| InChI | InChI=1S/C9H15N3/c1-7(11)9(5-10)8-3-2-4-12-6-8/h3,5,10,12H,2,4,6,11H2,1H3/b9-7+,10-5+ |
| InChIKey | IOGPPCVITZAAHC-JCVPOOLXSA-N |
| XLogP | 0.79 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|