About 4-methyl-2,3-dihydro-1H-pyrrolo[3,4-b]pyridine
4-methyl-2,3-dihydro-1H-pyrrolo[3,4-b]pyridine (PubChem CID 19826811) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 4-methyl-2,3-dihydro-1H-pyrrolo[3,4-b]pyridine.
Molecular Properties
| Compound Name | 4-methyl-2,3-dihydro-1H-pyrrolo[3,4-b]pyridine |
| PubChem CID | 19826811 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 4-methyl-2,3-dihydro-1H-pyrrolo[3,4-b]pyridine |
| SMILES | CC1=C2C=NC=C2NCC1 |
| InChI | InChI=1S/C8H10N2/c1-6-2-3-10-8-5-9-4-7(6)8/h4-5,10H,2-3H2,1H3 |
| InChIKey | KGVRFXMZSIBAFX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-2,3-dihydro-1H-pyrrolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,3-dihydro-1H-pyrrolo[3,4-b]pyridine?
The IUPAC name of 4-methyl-2,3-dihydro-1H-pyrrolo[3,4-b]pyridine (CID 19826811) is 4-methyl-2,3-dihydro-1H-pyrrolo[3,4-b]pyridine.
What is the SMILES notation for 4-methyl-2,3-dihydro-1H-pyrrolo[3,4-b]pyridine?
The canonical SMILES for 4-methyl-2,3-dihydro-1H-pyrrolo[3,4-b]pyridine is CC1=C2C=NC=C2NCC1.
What is the InChIKey of 4-methyl-2,3-dihydro-1H-pyrrolo[3,4-b]pyridine?
The InChIKey is KGVRFXMZSIBAFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2/c1-6-2-3-10-8-5-9-4-7(6)8/h4-5,10H,2-3H2,1H3.
What are the key properties of 4-methyl-2,3-dihydro-1H-pyrrolo[3,4-b]pyridine?
4-methyl-2,3-dihydro-1H-pyrrolo[3,4-b]pyridine has a molecular weight of 134.18 g/mol, XLogP of 1.22, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,3-dihydro-1H-pyrrolo[3,4-b]pyridine is sourced from PubChem (CID 19826811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).