C8H10N2 — CID 19826811
4-methyl-2,3-dihydro-1H-pyrrolo[3,4-b]pyridine (PubChem CID 19826811) has the molecular formula C8H10N2 and a molecular weight of 134.18 g/mol. Its IUPAC name is 4-methyl-2,3-dihydro-1H-pyrrolo[3,4-b]pyridine.
| Compound Name | 4-methyl-2,3-dihydro-1H-pyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 19826811 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 4-methyl-2,3-dihydro-1H-pyrrolo[3,4-b]pyridine |
| SMILES | CC1=C2C=NC=C2NCC1 |
| InChI | InChI=1S/C8H10N2/c1-6-2-3-10-8-5-9-4-7(6)8/h4-5,10H,2-3H2,1H3 |
| InChIKey | KGVRFXMZSIBAFX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |