C10H14N2 — CID 144512537
1-[(4Z)-4-ethylidene-3-methyl-5-methylidene-1H-pyrrol-2-yl]-N-methylmethanimine (PubChem CID 144512537) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 1-[(4Z)-4-ethylidene-3-methyl-5-methylidene-1H-pyrrol-2-yl]-N-methylmethanimine.
| Compound Name | 1-[(4Z)-4-ethylidene-3-methyl-5-methylidene-1H-pyrrol-2-yl]-N-methylmethanimine |
|---|---|
| PubChem CID | 144512537 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 1-[(4Z)-4-ethylidene-3-methyl-5-methylidene-1H-pyrrol-2-yl]-N-methylmethanimine |
| SMILES | C=c1[nH]c(/C=N/C)c(C)/c1=C/C |
| InChI | InChI=1S/C10H14N2/c1-5-9-7(2)10(6-11-4)12-8(9)3/h5-6,12H,3H2,1-2,4H3/b9-5-,11-6+ |
| InChIKey | AVGHCDBPRRAYQN-YCQMDOFOSA-N |
| XLogP | 0.58 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|