C12H18N2 — CID 142150605
4,5-bis(ethenyl)-N-methyl-2-methylidene-1H-pyrrol-3-imine;ethane (PubChem CID 142150605) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 4,5-bis(ethenyl)-N-methyl-2-methylidene-1H-pyrrol-3-imine;ethane.
| Compound Name | 4,5-bis(ethenyl)-N-methyl-2-methylidene-1H-pyrrol-3-imine;ethane |
|---|---|
| PubChem CID | 142150605 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 4,5-bis(ethenyl)-N-methyl-2-methylidene-1H-pyrrol-3-imine;ethane |
| SMILES | C=CC1=C(C=C)/C(=N/C)C(=C)N1.CC |
| InChI | InChI=1S/C10H12N2.C2H6/c1-5-8-9(6-2)12-7(3)10(8)11-4;1-2/h5-6,12H,1-3H2,4H3;1-2H3/b11-10+; |
| InChIKey | HFVNXMGZIDEPFN-ASTDGNLGSA-N |
| XLogP | 2.83 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|