C18H28N2 — CID 162747522
N-tert-butyl-3-[(4Z)-6-methyl-3-methylidenehepta-1,4,6-trien-2-yl]iminopent-4-en-1-amine (PubChem CID 162747522) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is N-tert-butyl-3-[(4Z)-6-methyl-3-methylidenehepta-1,4,6-trien-2-yl]iminopent-4-en-1-amine.
| Compound Name | N-tert-butyl-3-[(4Z)-6-methyl-3-methylidenehepta-1,4,6-trien-2-yl]iminopent-4-en-1-amine |
|---|---|
| PubChem CID | 162747522 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | N-tert-butyl-3-[(4Z)-6-methyl-3-methylidenehepta-1,4,6-trien-2-yl]iminopent-4-en-1-amine |
| SMILES | C=C/C(CCNC(C)(C)C)=N\C(=C)C(=C)/C=C\C(=C)C |
| InChI | InChI=1S/C18H28N2/c1-9-17(12-13-19-18(6,7)8)20-16(5)15(4)11-10-14(2)3/h9-11,19H,1-2,4-5,12-13H2,3,6-8H3/b11-10-,20-17+ |
| InChIKey | WPRFKRQMYFHALR-ZVDZJOMHSA-N |
| XLogP | 4.59 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|