C14H20N2 — CID 143181453
(4E)-4-[(Z)-but-2-enylidene]-N-tert-butyl-5-methylidenepyridin-3-amine (PubChem CID 143181453) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is (4E)-4-[(Z)-but-2-enylidene]-N-tert-butyl-5-methylidenepyridin-3-amine.
| Compound Name | (4E)-4-[(Z)-but-2-enylidene]-N-tert-butyl-5-methylidenepyridin-3-amine |
|---|---|
| PubChem CID | 143181453 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | (4E)-4-[(Z)-but-2-enylidene]-N-tert-butyl-5-methylidenepyridin-3-amine |
| SMILES | C=c1cncc(NC(C)(C)C)/c1=C/C=C\C |
| InChI | InChI=1S/C14H20N2/c1-6-7-8-12-11(2)9-15-10-13(12)16-14(3,4)5/h6-10,16H,2H2,1,3-5H3/b7-6-,12-8+ |
| InChIKey | KARXBINKTLTDCR-UGLNBITBSA-N |
| XLogP | 2.06 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |