C11H16N2 — CID 123977542
N-prop-1-enyl-2-(1,2,3,6-tetrahydropyridin-2-yl)prop-2-en-1-imine (PubChem CID 123977542) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is N-prop-1-enyl-2-(1,2,3,6-tetrahydropyridin-2-yl)prop-2-en-1-imine.
| Compound Name | N-prop-1-enyl-2-(1,2,3,6-tetrahydropyridin-2-yl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 123977542 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | N-prop-1-enyl-2-(1,2,3,6-tetrahydropyridin-2-yl)prop-2-en-1-imine |
| SMILES | C=C(/C=N/C=CC)C1CC=CCN1 |
| InChI | InChI=1S/C11H16N2/c1-3-7-12-9-10(2)11-6-4-5-8-13-11/h3-5,7,9,11,13H,2,6,8H2,1H3/b7-3?,12-9+ |
| InChIKey | ASZDPDIMRYJBMQ-PHOGLULASA-N |
| XLogP | 2.07 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|