C9H11N3 — CID 124191614
5-(1,2-Dihydropyridin-2-yl)-1,2-dihydropyrimidine (PubChem CID 124191614) has the molecular formula C9H11N3 and a molecular weight of 161.20 g/mol. Its IUPAC name is 5-(1,2-dihydropyridin-2-yl)-1,2-dihydropyrimidine.
| Compound Name | 5-(1,2-Dihydropyridin-2-yl)-1,2-dihydropyrimidine |
|---|---|
| PubChem CID | 124191614 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 5-(1,2-dihydropyridin-2-yl)-1,2-dihydropyrimidine |
| SMILES | C1NC=C(C=N1)C2C=CC=CN2 |
| InChI | InChI=1S/C9H11N3/c1-2-4-12-9(3-1)8-5-10-7-11-6-8/h1-6,9-10,12H,7H2 |
| InChIKey | ONIYBDDUQLYRSS-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 36.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | 273 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |