C11H13N3 — CID 123212757
5-N-ethyl-6-methylideneisoindole-1,5-diamine (PubChem CID 123212757) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 5-N-ethyl-6-methylideneisoindole-1,5-diamine.
| Compound Name | 5-N-ethyl-6-methylideneisoindole-1,5-diamine |
|---|---|
| PubChem CID | 123212757 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 5-N-ethyl-6-methylideneisoindole-1,5-diamine |
| SMILES | C=c1cc2c(cc1NCC)=CN=C2N |
| InChI | InChI=1S/C11H13N3/c1-3-13-10-5-8-6-14-11(12)9(8)4-7(10)2/h4-6,13H,2-3H2,1H3,(H2,12,14) |
| InChIKey | YUQXAYPUUZFIKC-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |