C8H12FN3 — CID 139358049
(Z)-3-amino-2-(1,2,3,6-tetrahydropyridin-5-yl)prop-2-enimidoyl fluoride (PubChem CID 139358049) has the molecular formula C8H12FN3 and a molecular weight of 169.20 g/mol. Its IUPAC name is (Z)-3-amino-2-(1,2,3,6-tetrahydropyridin-5-yl)prop-2-enimidoyl fluoride.
| Compound Name | (Z)-3-amino-2-(1,2,3,6-tetrahydropyridin-5-yl)prop-2-enimidoyl fluoride |
|---|---|
| PubChem CID | 139358049 |
| Molecular Formula | C8H12FN3 |
| Molecular Weight | 169.20 g/mol |
| Exact Mass | 169.10 |
| IUPAC Name | (Z)-3-amino-2-(1,2,3,6-tetrahydropyridin-5-yl)prop-2-enimidoyl fluoride |
| SMILES | [H]/N=C(F)/C(=C\N)C1=CCCNC1 |
| InChI | InChI=1S/C8H12FN3/c9-8(11)7(4-10)6-2-1-3-12-5-6/h2,4,11-12H,1,3,5,10H2/b7-4-,11-8- |
| InChIKey | KGJLTEUOZOQRQX-XGBXBTFKSA-N |
| XLogP | 0.70 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.20 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|