C21H34N2 — CID 142583824
(2E,4Z)-7-(butan-2-yliminomethyl)-N,8-dimethyl-4-[(3Z)-penta-1,3-dien-3-yl]nona-2,4,7-trien-2-amine (PubChem CID 142583824) has the molecular formula C21H34N2 and a molecular weight of 314.52 g/mol. Its IUPAC name is (2E,4Z)-7-(butan-2-yliminomethyl)-N,8-dimethyl-4-[(3Z)-penta-1,3-dien-3-yl]nona-2,4,7-trien-2-amine.
| Compound Name | (2E,4Z)-7-(butan-2-yliminomethyl)-N,8-dimethyl-4-[(3Z)-penta-1,3-dien-3-yl]nona-2,4,7-trien-2-amine |
|---|---|
| PubChem CID | 142583824 |
| Molecular Formula | C21H34N2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.27 |
| IUPAC Name | (2E,4Z)-7-(butan-2-yliminomethyl)-N,8-dimethyl-4-[(3Z)-penta-1,3-dien-3-yl]nona-2,4,7-trien-2-amine |
| SMILES | C=C/C(=C/C)C(=CCC(/C=N/C(C)CC)=C(C)C)/C=C(\C)NC |
| InChI | InChI=1S/C21H34N2/c1-9-17(6)23-15-21(16(4)5)13-12-20(14-18(7)22-8)19(10-2)11-3/h10-12,14-15,17,22H,2,9,13H2,1,3-8H3/b18-14+,19-11-,20-12-,23-15+ |
| InChIKey | KSRPDDMWCKZLKK-VPIHYJDLSA-N |
| XLogP | 5.76 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|