C19H26N2 — CID 176704586
(4E)-6-[[(Z)-2-cyclopropylbut-2-enylidene]amino]-N,5-bis(ethenyl)-2-methylhepta-2,4,6-trien-3-amine (PubChem CID 176704586) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is (4E)-6-[[(Z)-2-cyclopropylbut-2-enylidene]amino]-N,5-bis(ethenyl)-2-methylhepta-2,4,6-trien-3-amine.
| Compound Name | (4E)-6-[[(Z)-2-cyclopropylbut-2-enylidene]amino]-N,5-bis(ethenyl)-2-methylhepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 176704586 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | (4E)-6-[[(Z)-2-cyclopropylbut-2-enylidene]amino]-N,5-bis(ethenyl)-2-methylhepta-2,4,6-trien-3-amine |
| SMILES | C=CNC(/C=C(\C=C)C(=C)/N=C\C(=C/C)C1CC1)=C(C)C |
| InChI | InChI=1S/C19H26N2/c1-7-16(12-19(14(4)5)20-9-3)15(6)21-13-17(8-2)18-10-11-18/h7-9,12-13,18,20H,1,3,6,10-11H2,2,4-5H3/b16-12+,17-8+,21-13+ |
| InChIKey | ZUMSKHJMQPOYOQ-BKCZJLNDSA-N |
| XLogP | 5.07 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|