C22H29F3N2 — CID 167506828
(E)-5-[(1E,3E,5Z)-6-cyclopropyl-2,3-dimethyl-5-(trifluoromethyl)hepta-1,3,5-trienyl]imino-N-ethenyl-4-methylidenehex-2-en-2-amine (PubChem CID 167506828) has the molecular formula C22H29F3N2 and a molecular weight of 378.48 g/mol. Its IUPAC name is (E)-5-[(1E,3E,5Z)-6-cyclopropyl-2,3-dimethyl-5-(trifluoromethyl)hepta-1,3,5-trienyl]imino-N-ethenyl-4-methylidenehex-2-en-2-amine.
| Compound Name | (E)-5-[(1E,3E,5Z)-6-cyclopropyl-2,3-dimethyl-5-(trifluoromethyl)hepta-1,3,5-trienyl]imino-N-ethenyl-4-methylidenehex-2-en-2-amine |
|---|---|
| PubChem CID | 167506828 |
| Molecular Formula | C22H29F3N2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | (E)-5-[(1E,3E,5Z)-6-cyclopropyl-2,3-dimethyl-5-(trifluoromethyl)hepta-1,3,5-trienyl]imino-N-ethenyl-4-methylidenehex-2-en-2-amine |
| SMILES | C=CN/C(C)=C/C(=C)/C(C)=N/C=C(C)/C(C)=C/C(=C(\C)C1CC1)C(F)(F)F |
| InChI | InChI=1S/C22H29F3N2/c1-8-26-17(5)11-15(3)19(7)27-13-16(4)14(2)12-21(22(23,24)25)18(6)20-9-10-20/h8,11-13,20,26H,1,3,9-10H2,2,4-7H3/b14-12+,16-13+,17-11+,21-18-,27-19+ |
| InChIKey | ZWMVWKNTMGFLAN-FHFGDKEOSA-N |
| XLogP | 6.78 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|