C24H35F3N2 — CID 167506827
(E)-5-[(1E,3E,5Z)-6-cyclopropyl-2,3-dimethyl-5-(trifluoromethyl)hepta-1,3,5-trienyl]imino-N-ethenyl-4-methylidenehex-2-en-2-amine;ethane (PubChem CID 167506827) has the molecular formula C24H35F3N2 and a molecular weight of 408.55 g/mol. Its IUPAC name is (E)-5-[(1E,3E,5Z)-6-cyclopropyl-2,3-dimethyl-5-(trifluoromethyl)hepta-1,3,5-trienyl]imino-N-ethenyl-4-methylidenehex-2-en-2-amine;ethane.
| Compound Name | (E)-5-[(1E,3E,5Z)-6-cyclopropyl-2,3-dimethyl-5-(trifluoromethyl)hepta-1,3,5-trienyl]imino-N-ethenyl-4-methylidenehex-2-en-2-amine;ethane |
|---|---|
| PubChem CID | 167506827 |
| Molecular Formula | C24H35F3N2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | (E)-5-[(1E,3E,5Z)-6-cyclopropyl-2,3-dimethyl-5-(trifluoromethyl)hepta-1,3,5-trienyl]imino-N-ethenyl-4-methylidenehex-2-en-2-amine;ethane |
| SMILES | C=CN/C(C)=C/C(=C)/C(C)=N/C=C(C)/C(C)=C/C(=C(\C)C1CC1)C(F)(F)F.CC |
| InChI | InChI=1S/C22H29F3N2.C2H6/c1-8-26-17(5)11-15(3)19(7)27-13-16(4)14(2)12-21(22(23,24)25)18(6)20-9-10-20;1-2/h8,11-13,20,26H,1,3,9-10H2,2,4-7H3;1-2H3/b14-12+,16-13+,17-11+,21-18-,27-19+; |
| InChIKey | NJHPCLAOLCCQNN-WNRKQJRESA-N |
| XLogP | 7.81 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|