C22H28N2 — CID 135294800
(3Z,5E,6Z)-6-[[(2Z)-2-(2,4-dimethylcyclobuta-1,3-dien-1-yl)-4-methylpenta-2,4-dienylidene]amino]-5-ethylideneocta-1,3,6-trien-2-amine (PubChem CID 135294800) has the molecular formula C22H28N2 and a molecular weight of 320.48 g/mol. Its IUPAC name is (3Z,5E,6Z)-6-[[(2Z)-2-(2,4-dimethylcyclobuta-1,3-dien-1-yl)-4-methylpenta-2,4-dienylidene]amino]-5-ethylideneocta-1,3,6-trien-2-amine.
| Compound Name | (3Z,5E,6Z)-6-[[(2Z)-2-(2,4-dimethylcyclobuta-1,3-dien-1-yl)-4-methylpenta-2,4-dienylidene]amino]-5-ethylideneocta-1,3,6-trien-2-amine |
|---|---|
| PubChem CID | 135294800 |
| Molecular Formula | C22H28N2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | (3Z,5E,6Z)-6-[[(2Z)-2-(2,4-dimethylcyclobuta-1,3-dien-1-yl)-4-methylpenta-2,4-dienylidene]amino]-5-ethylideneocta-1,3,6-trien-2-amine |
| SMILES | C=C(C)/C=C(\C=N\C(=C/C)C(/C=C\C(=C)N)=C\C)C1=C(C)C=C1C |
| InChI | InChI=1S/C22H28N2/c1-8-19(11-10-18(7)23)21(9-2)24-14-20(12-15(3)4)22-16(5)13-17(22)6/h8-14H,3,7,23H2,1-2,4-6H3/b11-10-,19-8+,20-12+,21-9-,24-14+ |
| InChIKey | QJMIEDMFGAZQFI-JLOJFQRVSA-N |
| XLogP | 5.71 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|