C17H21N — CID 91217788
3-methyl-2-methylidene-N-(3-methylidenehepta-1,4,6-trien-2-yl)hepta-3,5-dien-1-imine (PubChem CID 91217788) has the molecular formula C17H21N and a molecular weight of 239.36 g/mol. Its IUPAC name is 3-methyl-2-methylidene-N-(3-methylidenehepta-1,4,6-trien-2-yl)hepta-3,5-dien-1-imine.
| Compound Name | 3-methyl-2-methylidene-N-(3-methylidenehepta-1,4,6-trien-2-yl)hepta-3,5-dien-1-imine |
|---|---|
| PubChem CID | 91217788 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 3-methyl-2-methylidene-N-(3-methylidenehepta-1,4,6-trien-2-yl)hepta-3,5-dien-1-imine |
| SMILES | C=CC=CC(=C)C(=C)/N=C\C(=C)C(C)=CC=CC |
| InChI | InChI=1S/C17H21N/c1-7-9-11-14(3)16(5)13-18-17(6)15(4)12-10-8-2/h7-13H,2,4-6H2,1,3H3/b9-7?,12-10?,14-11?,18-13+ |
| InChIKey | VNYSIIFRXZKHII-SZBXCWDQSA-N |
| XLogP | 4.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|