C12H16FN — CID 163875287
(E)-N-[(2E,5E)-3-fluoro-4-methylidenehepta-2,5-dien-2-yl]but-2-en-1-imine (PubChem CID 163875287) has the molecular formula C12H16FN and a molecular weight of 193.26 g/mol. Its IUPAC name is (E)-N-[(2E,5E)-3-fluoro-4-methylidenehepta-2,5-dien-2-yl]but-2-en-1-imine.
| Compound Name | (E)-N-[(2E,5E)-3-fluoro-4-methylidenehepta-2,5-dien-2-yl]but-2-en-1-imine |
|---|---|
| PubChem CID | 163875287 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.26 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | (E)-N-[(2E,5E)-3-fluoro-4-methylidenehepta-2,5-dien-2-yl]but-2-en-1-imine |
| SMILES | C=C(/C=C/C)/C(F)=C(C)\N=C\C=C\C |
| InChI | InChI=1S/C12H16FN/c1-5-7-9-14-11(4)12(13)10(3)8-6-2/h5-9H,3H2,1-2,4H3/b7-5+,8-6+,12-11+,14-9+ |
| InChIKey | POIGWJZGOZVUSD-IXJWNLNJSA-N |
| XLogP | 3.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.26 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|