About (2E,4E)-3-fluoro-N-methylhepta-2,4-dien-1-imine
(2E,4E)-3-fluoro-N-methylhepta-2,4-dien-1-imine (PubChem CID 129196363) has the molecular formula C8H12FN
and a molecular weight of 141.19 g/mol. Its IUPAC name is (2E,4E)-3-fluoro-N-methylhepta-2,4-dien-1-imine.
Molecular Properties
| Compound Name | (2E,4E)-3-fluoro-N-methylhepta-2,4-dien-1-imine |
| PubChem CID | 129196363 |
| Molecular Formula | C8H12FN |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | (2E,4E)-3-fluoro-N-methylhepta-2,4-dien-1-imine |
| SMILES | CC/C=C/C(F)=C\C=N\C |
| InChI | InChI=1S/C8H12FN/c1-3-4-5-8(9)6-7-10-2/h4-7H,3H2,1-2H3/b5-4+,8-6+,10-7+ |
| InChIKey | FFFFFTMEUFRRPU-JNKFYZEOSA-N |
| XLogP | 2.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-3-fluoro-N-methylhepta-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-3-fluoro-N-methylhepta-2,4-dien-1-imine?
The IUPAC name of (2E,4E)-3-fluoro-N-methylhepta-2,4-dien-1-imine (CID 129196363) is (2E,4E)-3-fluoro-N-methylhepta-2,4-dien-1-imine.
What is the SMILES notation for (2E,4E)-3-fluoro-N-methylhepta-2,4-dien-1-imine?
The canonical SMILES for (2E,4E)-3-fluoro-N-methylhepta-2,4-dien-1-imine is CC/C=C/C(F)=C\C=N\C.
What is the InChIKey of (2E,4E)-3-fluoro-N-methylhepta-2,4-dien-1-imine?
The InChIKey is FFFFFTMEUFRRPU-JNKFYZEOSA-N. The full InChI is InChI=1S/C8H12FN/c1-3-4-5-8(9)6-7-10-2/h4-7H,3H2,1-2H3/b5-4+,8-6+,10-7+.
What are the key properties of (2E,4E)-3-fluoro-N-methylhepta-2,4-dien-1-imine?
(2E,4E)-3-fluoro-N-methylhepta-2,4-dien-1-imine has a molecular weight of 141.19 g/mol, XLogP of 2.51, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-3-fluoro-N-methylhepta-2,4-dien-1-imine is sourced from PubChem (CID 129196363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).