C9H12F3N — CID 123834038
(2E)-3-methyl-N-(3,3,3-trifluoropropyl)penta-2,4-dien-1-imine (PubChem CID 123834038) has the molecular formula C9H12F3N and a molecular weight of 191.20 g/mol. Its IUPAC name is (2E)-3-methyl-N-(3,3,3-trifluoropropyl)penta-2,4-dien-1-imine.
| Compound Name | (2E)-3-methyl-N-(3,3,3-trifluoropropyl)penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 123834038 |
| Molecular Formula | C9H12F3N |
| Molecular Weight | 191.20 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (2E)-3-methyl-N-(3,3,3-trifluoropropyl)penta-2,4-dien-1-imine |
| SMILES | C=C/C(C)=C/C=N/CCC(F)(F)F |
| InChI | InChI=1S/C9H12F3N/c1-3-8(2)4-6-13-7-5-9(10,11)12/h3-4,6H,1,5,7H2,2H3/b8-4+,13-6+ |
| InChIKey | UHKNPNLPRIHHBI-OUMYDGPMSA-N |
| XLogP | 3.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.20 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|