About 2,5-dimethylidenepyridine
2,5-dimethylidenepyridine (PubChem CID 76588966) has the molecular formula C7H7N
and a molecular weight of 105.14 g/mol. Its IUPAC name is 2,5-dimethylidenepyridine.
Molecular Properties
| Compound Name | 2,5-dimethylidenepyridine |
| PubChem CID | 76588966 |
| Molecular Formula | C7H7N |
| Molecular Weight | 105.14 g/mol |
| Exact Mass | 105.06 |
| IUPAC Name | 2,5-dimethylidenepyridine |
| SMILES | C=c1ccc(=C)nc1 |
| InChI | InChI=1S/C7H7N/c1-6-3-4-7(2)8-5-6/h3-5H,1-2H2 |
| InChIKey | BEDDZDIIMKCBNX-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.14 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,5-dimethylidenepyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethylidenepyridine?
The IUPAC name of 2,5-dimethylidenepyridine (CID 76588966) is 2,5-dimethylidenepyridine.
What is the SMILES notation for 2,5-dimethylidenepyridine?
The canonical SMILES for 2,5-dimethylidenepyridine is C=c1ccc(=C)nc1.
What is the InChIKey of 2,5-dimethylidenepyridine?
The InChIKey is BEDDZDIIMKCBNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N/c1-6-3-4-7(2)8-5-6/h3-5H,1-2H2.
What are the key properties of 2,5-dimethylidenepyridine?
2,5-dimethylidenepyridine has a molecular weight of 105.14 g/mol, XLogP of -0.10, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethylidenepyridine is sourced from PubChem (CID 76588966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).