C17H23F2N3 — CID 163864124
(2Z,4E,6E)-3-[[(2E,4E)-2-ethenyl-5-fluorohexa-2,4-dienyl]amino]-6-fluoro-4-methylocta-2,4,6-trienimidamide (PubChem CID 163864124) has the molecular formula C17H23F2N3 and a molecular weight of 307.39 g/mol. Its IUPAC name is (2Z,4E,6E)-3-[[(2E,4E)-2-ethenyl-5-fluorohexa-2,4-dienyl]amino]-6-fluoro-4-methylocta-2,4,6-trienimidamide.
| Compound Name | (2Z,4E,6E)-3-[[(2E,4E)-2-ethenyl-5-fluorohexa-2,4-dienyl]amino]-6-fluoro-4-methylocta-2,4,6-trienimidamide |
|---|---|
| PubChem CID | 163864124 |
| Molecular Formula | C17H23F2N3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (2Z,4E,6E)-3-[[(2E,4E)-2-ethenyl-5-fluorohexa-2,4-dienyl]amino]-6-fluoro-4-methylocta-2,4,6-trienimidamide |
| SMILES | [H]/N=C(N)/C=C(NC/C(C=C)=C/C=C(\C)F)/C(C)=C/C(F)=C\C |
| InChI | InChI=1S/C17H23F2N3/c1-5-14(8-7-13(4)18)11-22-16(10-17(20)21)12(3)9-15(19)6-2/h5-10,22H,1,11H2,2-4H3,(H3,20,21)/b12-9+,13-7+,14-8+,15-6+,16-10- |
| InChIKey | PFDBUJSUBMEQOX-CTCUYASKSA-N |
| XLogP | 4.20 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|