C15H24N4 — CID 177354927
(2Z,4E,7E)-4-amino-8-methyl-5-[2-(methylamino)ethenyl]-6-methylidenedeca-2,4,7-trienimidamide (PubChem CID 177354927) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is (2Z,4E,7E)-4-amino-8-methyl-5-[2-(methylamino)ethenyl]-6-methylidenedeca-2,4,7-trienimidamide.
| Compound Name | (2Z,4E,7E)-4-amino-8-methyl-5-[2-(methylamino)ethenyl]-6-methylidenedeca-2,4,7-trienimidamide |
|---|---|
| PubChem CID | 177354927 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | (2Z,4E,7E)-4-amino-8-methyl-5-[2-(methylamino)ethenyl]-6-methylidenedeca-2,4,7-trienimidamide |
| SMILES | [H]/N=C(N)/C=C\C(N)=C(\C=CNC)C(=C)/C=C(\C)CC |
| InChI | InChI=1S/C15H24N4/c1-5-11(2)10-12(3)13(8-9-19-4)14(16)6-7-15(17)18/h6-10,19H,3,5,16H2,1-2,4H3,(H3,17,18)/b7-6-,9-8?,11-10+,14-13+ |
| InChIKey | DROLAKPXUBJLCX-RHWKGHBCSA-N |
| XLogP | 2.34 |
| TPSA | 87.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|