C13H25N3 — CID 143923794
ethane;(Z)-3-[[(3E)-hexa-1,3,5-trien-3-yl]amino]prop-2-enimidamide (PubChem CID 143923794) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is ethane;(Z)-3-[[(3E)-hexa-1,3,5-trien-3-yl]amino]prop-2-enimidamide.
| Compound Name | ethane;(Z)-3-[[(3E)-hexa-1,3,5-trien-3-yl]amino]prop-2-enimidamide |
|---|---|
| PubChem CID | 143923794 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | ethane;(Z)-3-[[(3E)-hexa-1,3,5-trien-3-yl]amino]prop-2-enimidamide |
| SMILES | CC.CC.[H]/N=C(N)/C=C\N/C(C=C)=C/C=C |
| InChI | InChI=1S/C9H13N3.2C2H6/c1-3-5-8(4-2)12-7-6-9(10)11;2*1-2/h3-7,12H,1-2H2,(H3,10,11);2*1-2H3/b7-6-,8-5+;; |
| InChIKey | WOHQQSKMEZGUCB-VTVSZGPUSA-N |
| XLogP | 3.33 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|