C10H18N4 — CID 137387818
(Z)-3-[methyl-[(2E)-4-(methylamino)penta-2,4-dien-2-yl]amino]prop-2-enimidamide (PubChem CID 137387818) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is (Z)-3-[methyl-[(2E)-4-(methylamino)penta-2,4-dien-2-yl]amino]prop-2-enimidamide.
| Compound Name | (Z)-3-[methyl-[(2E)-4-(methylamino)penta-2,4-dien-2-yl]amino]prop-2-enimidamide |
|---|---|
| PubChem CID | 137387818 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | (Z)-3-[methyl-[(2E)-4-(methylamino)penta-2,4-dien-2-yl]amino]prop-2-enimidamide |
| SMILES | [H]/N=C(N)/C=C\N(C)/C(C)=C/C(=C)NC |
| InChI | InChI=1S/C10H18N4/c1-8(13-3)7-9(2)14(4)6-5-10(11)12/h5-7,13H,1H2,2-4H3,(H3,11,12)/b6-5-,9-7+ |
| InChIKey | IEPPDGDLPFOABK-BZWSEGBZSA-N |
| XLogP | 1.00 |
| TPSA | 65.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|